C9H13NO3 — CID 11206173
methyl (1R,8R)-7-oxo-1,2,3,5,6,8-hexahydropyrrolizine-1-carboxylate (PubChem CID 11206173) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl (1R,8R)-7-oxo-1,2,3,5,6,8-hexahydropyrrolizine-1-carboxylate.
| Compound Name | methyl (1R,8R)-7-oxo-1,2,3,5,6,8-hexahydropyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 11206173 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | methyl (1R,8R)-7-oxo-1,2,3,5,6,8-hexahydropyrrolizine-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN2CCC(=O)[C@@H]12 |
| InChI | InChI=1S/C9H13NO3/c1-13-9(12)6-2-4-10-5-3-7(11)8(6)10/h6,8H,2-5H2,1H3/t6-,8-/m1/s1 |
| InChIKey | SLUDNQCNLDBKCE-HTRCEHHLSA-N |
| XLogP | -0.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |