C12H14N2O — CID 11206463
(1Z)-1-benzylidene-5,5-dimethyl-4H-pyrazol-1-ium-3-olate (PubChem CID 11206463) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (1Z)-1-benzylidene-5,5-dimethyl-4H-pyrazol-1-ium-3-olate.
| Compound Name | (1Z)-1-benzylidene-5,5-dimethyl-4H-pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 11206463 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (1Z)-1-benzylidene-5,5-dimethyl-4H-pyrazol-1-ium-3-olate |
| SMILES | CC1(C)CC([O-])=N/[N+]1=C\c1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c1-12(2)8-11(15)13-14(12)9-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3/b14-9- |
| InChIKey | MWGXVOKCYXOTRU-ZROIWOOFSA-N |
| XLogP | 0.97 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|