C12H13ClN2O — CID 6314447
(1Z)-1-[(4-chlorophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate (PubChem CID 6314447) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is (1Z)-1-[(4-chlorophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate.
| Compound Name | (1Z)-1-[(4-chlorophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 6314447 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (1Z)-1-[(4-chlorophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate |
| SMILES | CC1(C)CC([O-])=N/[N+]1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O/c1-12(2)7-11(16)14-15(12)8-9-3-5-10(13)6-4-9/h3-6,8H,7H2,1-2H3/b15-8- |
| InChIKey | PFYCKPMXMIRFHD-NVNXTCNLSA-N |
| XLogP | 1.63 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|