C13H18O5 — CID 11207526
methyl (2E,4E)-5-[(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoate (PubChem CID 11207526) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl (2E,4E)-5-[(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-[(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 11207526 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | methyl (2E,4E)-5-[(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C(\C)[C@@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C13H18O5/c1-9(6-5-7-11(15)16-4)12-10(8-14)17-13(2,3)18-12/h5-8,10,12H,1-4H3/b7-5+,9-6+/t10-,12-/m0/s1 |
| InChIKey | QEQUZJJZGCEYOZ-DZLFQXEVSA-N |
| XLogP | 1.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|