C12H18O5 — CID 134895890
(4S,5R)-4,5-bis(methoxymethoxy)-3-[(E)-prop-1-enyl]cyclopent-2-en-1-one (PubChem CID 134895890) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (4S,5R)-4,5-bis(methoxymethoxy)-3-[(E)-prop-1-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5R)-4,5-bis(methoxymethoxy)-3-[(E)-prop-1-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 134895890 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (4S,5R)-4,5-bis(methoxymethoxy)-3-[(E)-prop-1-enyl]cyclopent-2-en-1-one |
| SMILES | C/C=C/C1=CC(=O)[C@H](OCOC)[C@H]1OCOC |
| InChI | InChI=1S/C12H18O5/c1-4-5-9-6-10(13)12(17-8-15-3)11(9)16-7-14-2/h4-6,11-12H,7-8H2,1-3H3/b5-4+/t11-,12-/m0/s1 |
| InChIKey | DPSQQJNUEYFXSR-XMXMHJJKSA-N |
| XLogP | 1.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|