C9H5Cl3F3N — CID 11208537
(1Z)-4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzenecarboximidoyl chloride (PubChem CID 11208537) has the molecular formula C9H5Cl3F3N and a molecular weight of 290.50 g/mol. Its IUPAC name is (1Z)-4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzenecarboximidoyl chloride.
| Compound Name | (1Z)-4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 11208537 |
| Molecular Formula | C9H5Cl3F3N |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 288.94 |
| IUPAC Name | (1Z)-4-chloro-N-(1-chloro-2,2,2-trifluoroethyl)benzenecarboximidoyl chloride |
| SMILES | FC(F)(F)C(Cl)/N=C(\Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H5Cl3F3N/c10-6-3-1-5(2-4-6)7(11)16-8(12)9(13,14)15/h1-4,8H/b16-7- |
| InChIKey | IUUMAHGAQHEILA-APSNUPSMSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|