C14H8Cl2N4 — CID 11208882
4,6-bis(6-chloro-3-pyridinyl)pyrimidine (PubChem CID 11208882) has the molecular formula C14H8Cl2N4 and a molecular weight of 303.15 g/mol. Its IUPAC name is 4,6-bis(6-chloro-3-pyridinyl)pyrimidine.
| Compound Name | 4,6-bis(6-chloro-3-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 11208882 |
| Molecular Formula | C14H8Cl2N4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 4,6-bis(6-chloro-3-pyridinyl)pyrimidine |
| SMILES | Clc1ccc(-c2cc(-c3ccc(Cl)nc3)ncn2)cn1 |
| InChI | InChI=1S/C14H8Cl2N4/c15-13-3-1-9(6-17-13)11-5-12(20-8-19-11)10-2-4-14(16)18-7-10/h1-8H |
| InChIKey | LZQHIMZOUQOBKU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|