C17H30F2OSi — CID 11209296
1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentan-1-ol (PubChem CID 11209296) has the molecular formula C17H30F2OSi and a molecular weight of 316.51 g/mol. Its IUPAC name is 1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentan-1-ol.
| Compound Name | 1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 11209296 |
| Molecular Formula | C17H30F2OSi |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclopentan-1-ol |
| SMILES | CC(C)[Si](C#CC(F)(F)C1(O)CCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H30F2OSi/c1-13(2)21(14(3)4,15(5)6)12-11-17(18,19)16(20)9-7-8-10-16/h13-15,20H,7-10H2,1-6H3 |
| InChIKey | FOXZNNMIQIKDMP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|