C18H32F2OSi — CID 15495761
1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclohexan-1-ol (PubChem CID 15495761) has the molecular formula C18H32F2OSi and a molecular weight of 330.54 g/mol. Its IUPAC name is 1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclohexan-1-ol.
| Compound Name | 1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 15495761 |
| Molecular Formula | C18H32F2OSi |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]cyclohexan-1-ol |
| SMILES | CC(C)[Si](C#CC(F)(F)C1(O)CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H32F2OSi/c1-14(2)22(15(3)4,16(5)6)13-12-18(19,20)17(21)10-8-7-9-11-17/h14-16,21H,7-11H2,1-6H3 |
| InChIKey | OFWKIAVTJYIJMT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|