C19H34F2OSi — CID 15495756
1-cyclohexyl-2,2-difluoro-4-tri(propan-2-yl)silylbut-3-yn-1-ol (PubChem CID 15495756) has the molecular formula C19H34F2OSi and a molecular weight of 344.56 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-difluoro-4-tri(propan-2-yl)silylbut-3-yn-1-ol.
| Compound Name | 1-cyclohexyl-2,2-difluoro-4-tri(propan-2-yl)silylbut-3-yn-1-ol |
|---|---|
| PubChem CID | 15495756 |
| Molecular Formula | C19H34F2OSi |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 1-cyclohexyl-2,2-difluoro-4-tri(propan-2-yl)silylbut-3-yn-1-ol |
| SMILES | CC(C)[Si](C#CC(F)(F)C(O)C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34F2OSi/c1-14(2)23(15(3)4,16(5)6)13-12-19(20,21)18(22)17-10-8-7-9-11-17/h14-18,22H,7-11H2,1-6H3 |
| InChIKey | QZKLHOAHOBJZRQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|