C17H34OSi — CID 102080041
(3S,4R)-2-methyl-4-(2-trimethylsilylethynyl)undecan-3-ol (PubChem CID 102080041) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is (3S,4R)-2-methyl-4-(2-trimethylsilylethynyl)undecan-3-ol.
| Compound Name | (3S,4R)-2-methyl-4-(2-trimethylsilylethynyl)undecan-3-ol |
|---|---|
| PubChem CID | 102080041 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (3S,4R)-2-methyl-4-(2-trimethylsilylethynyl)undecan-3-ol |
| SMILES | CCCCCCC[C@H](C#C[Si](C)(C)C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C17H34OSi/c1-7-8-9-10-11-12-16(17(18)15(2)3)13-14-19(4,5)6/h15-18H,7-12H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | WCDASULFPJALPC-SJORKVTESA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|