C24H42O2 — CID 163063685
(6R,15S)-15-methyltricosa-2,4-diyne-1,6-diol (PubChem CID 163063685) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is (6R,15S)-15-methyltricosa-2,4-diyne-1,6-diol.
| Compound Name | (6R,15S)-15-methyltricosa-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 163063685 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | (6R,15S)-15-methyltricosa-2,4-diyne-1,6-diol |
| SMILES | CCCCCCCC[C@H](C)CCCCCCCC[C@@H](O)C#CC#CCO |
| InChI | InChI=1S/C24H42O2/c1-3-4-5-6-9-13-18-23(2)19-14-10-7-8-11-15-20-24(26)21-16-12-17-22-25/h23-26H,3-11,13-15,18-20,22H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | VJTDCONECWWPIO-BJKOFHAPSA-N |
| XLogP | 5.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|