C14H23F3OSi — CID 134968789
(2R)-2-cyclohexyl-1,1,1-trifluoro-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 134968789) has the molecular formula C14H23F3OSi and a molecular weight of 292.42 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-1,1,1-trifluoro-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | (2R)-2-cyclohexyl-1,1,1-trifluoro-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 134968789 |
| Molecular Formula | C14H23F3OSi |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2R)-2-cyclohexyl-1,1,1-trifluoro-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | C[Si](C)(C)C#CC[C@@](O)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H23F3OSi/c1-19(2,3)11-7-10-13(18,14(15,16)17)12-8-5-4-6-9-12/h12,18H,4-6,8-10H2,1-3H3/t13-/m1/s1 |
| InChIKey | KBRFCTGBOUXILN-CYBMUJFWSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|