C12H26OSi — CID 154723356
2-[(1S,2R)-2-trimethylsilylcyclohexyl]propan-2-ol (PubChem CID 154723356) has the molecular formula C12H26OSi and a molecular weight of 214.42 g/mol. Its IUPAC name is 2-[(1S,2R)-2-trimethylsilylcyclohexyl]propan-2-ol.
| Compound Name | 2-[(1S,2R)-2-trimethylsilylcyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 154723356 |
| Molecular Formula | C12H26OSi |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-[(1S,2R)-2-trimethylsilylcyclohexyl]propan-2-ol |
| SMILES | CC(C)(O)[C@@H]1CCCC[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C12H26OSi/c1-12(2,13)10-8-6-7-9-11(10)14(3,4)5/h10-11,13H,6-9H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | QOKBMUSMFWRPNW-GHMZBOCLSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|