C22H30Si — CID 11209497
(2,2-diphenylcyclopropyl)methyl-triethylsilane (PubChem CID 11209497) has the molecular formula C22H30Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (2,2-diphenylcyclopropyl)methyl-triethylsilane.
| Compound Name | (2,2-diphenylcyclopropyl)methyl-triethylsilane |
|---|---|
| PubChem CID | 11209497 |
| Molecular Formula | C22H30Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (2,2-diphenylcyclopropyl)methyl-triethylsilane |
| SMILES | CC[Si](CC)(CC)CC1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30Si/c1-4-23(5-2,6-3)18-21-17-22(21,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21H,4-6,17-18H2,1-3H3 |
| InChIKey | XCNWDZWNUDNUTD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|