C16H18 — CID 15203
1,1'-(1-Methyl-1,3-propanediyl)bis(benzene) (PubChem CID 15203) has the molecular formula C16H18 and a molecular weight of 210.31 g/mol. Its IUPAC name is 4-phenylbutan-2-ylbenzene.
| Compound Name | 1,1'-(1-Methyl-1,3-propanediyl)bis(benzene) |
|---|---|
| PubChem CID | 15203 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-phenylbutan-2-ylbenzene |
| SMILES | CC(CCC1=CC=CC=C1)C2=CC=CC=C2 |
| InChI | InChI=1S/C16H18/c1-14(16-10-6-3-7-11-16)12-13-15-8-4-2-5-9-15/h2-11,14H,12-13H2,1H3 |
| InChIKey | PDINXYLAVFUHSA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | 172 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |