C15H19Cl2FN2O — CID 11209793
2,4-dichloro-5-fluoro-N-(2-methylpropyl)-N-pyrrolidin-3-ylbenzamide (PubChem CID 11209793) has the molecular formula C15H19Cl2FN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(2-methylpropyl)-N-pyrrolidin-3-ylbenzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(2-methylpropyl)-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 11209793 |
| Molecular Formula | C15H19Cl2FN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(2-methylpropyl)-N-pyrrolidin-3-ylbenzamide |
| SMILES | CC(C)CN(C(=O)c1cc(F)c(Cl)cc1Cl)C1CCNC1 |
| InChI | InChI=1S/C15H19Cl2FN2O/c1-9(2)8-20(10-3-4-19-7-10)15(21)11-5-14(18)13(17)6-12(11)16/h5-6,9-10,19H,3-4,7-8H2,1-2H3 |
| InChIKey | ULVTVXTUDDHYBY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|