C17H24Cl2N2O — CID 11450731
2,4-dichloro-N-(2-ethylbutyl)-N-pyrrolidin-3-ylbenzamide (PubChem CID 11450731) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-ethylbutyl)-N-pyrrolidin-3-ylbenzamide.
| Compound Name | 2,4-dichloro-N-(2-ethylbutyl)-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 11450731 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2,4-dichloro-N-(2-ethylbutyl)-N-pyrrolidin-3-ylbenzamide |
| SMILES | CCC(CC)CN(C(=O)c1ccc(Cl)cc1Cl)C1CCNC1 |
| InChI | InChI=1S/C17H24Cl2N2O/c1-3-12(4-2)11-21(14-7-8-20-10-14)17(22)15-6-5-13(18)9-16(15)19/h5-6,9,12,14,20H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | GOECCNKDOKBGOI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |