C18H15ClN2O4 — CID 11210558
N-[3-(6-chloro-2-oxochromen-4-yl)oxypropyl]pyridine-4-carboxamide (PubChem CID 11210558) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is N-[3-(6-chloro-2-oxochromen-4-yl)oxypropyl]pyridine-4-carboxamide.
| Compound Name | N-[3-(6-chloro-2-oxochromen-4-yl)oxypropyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11210558 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[3-(6-chloro-2-oxochromen-4-yl)oxypropyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCCOc1cc(=O)oc2ccc(Cl)cc12)c1ccncc1 |
| InChI | InChI=1S/C18H15ClN2O4/c19-13-2-3-15-14(10-13)16(11-17(22)25-15)24-9-1-6-21-18(23)12-4-7-20-8-5-12/h2-5,7-8,10-11H,1,6,9H2,(H,21,23) |
| InChIKey | WTGDYDGPYUGKCR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|