C16H34O6Si2 — CID 11211146
trimethoxy-[(1E,9E)-10-trimethoxysilyldeca-1,9-dienyl]silane (PubChem CID 11211146) has the molecular formula C16H34O6Si2 and a molecular weight of 378.61 g/mol. Its IUPAC name is trimethoxy-[(1E,9E)-10-trimethoxysilyldeca-1,9-dienyl]silane.
| Compound Name | trimethoxy-[(1E,9E)-10-trimethoxysilyldeca-1,9-dienyl]silane |
|---|---|
| PubChem CID | 11211146 |
| Molecular Formula | C16H34O6Si2 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | trimethoxy-[(1E,9E)-10-trimethoxysilyldeca-1,9-dienyl]silane |
| SMILES | CO[Si](/C=C/CCCCCC/C=C/[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C16H34O6Si2/c1-17-23(18-2,19-3)15-13-11-9-7-8-10-12-14-16-24(20-4,21-5)22-6/h13-16H,7-12H2,1-6H3/b15-13+,16-14+ |
| InChIKey | GDLKAUFINQZTJU-WXUKJITCSA-N |
| XLogP | 3.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|