C18H30O7Si — CID 11211375
2-O-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl] 1-O,1-O-diethyl 2-hydroxyethane-1,1,2-tricarboxylate (PubChem CID 11211375) has the molecular formula C18H30O7Si and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-O-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl] 1-O,1-O-diethyl 2-hydroxyethane-1,1,2-tricarboxylate.
| Compound Name | 2-O-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl] 1-O,1-O-diethyl 2-hydroxyethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 11211375 |
| Molecular Formula | C18H30O7Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-O-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl] 1-O,1-O-diethyl 2-hydroxyethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(O)C(=O)OCC#C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O7Si/c1-8-23-15(20)13(16(21)24-9-2)14(19)17(22)25-11-10-12-26(6,7)18(3,4)5/h13-14,19H,8-9,11H2,1-7H3 |
| InChIKey | RWYBUTCFSPTWSB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|