C23H25NO4S — CID 11212065
methyl (3aR,5S,7aS)-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate (PubChem CID 11212065) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is methyl (3aR,5S,7aS)-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate.
| Compound Name | methyl (3aR,5S,7aS)-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 11212065 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | methyl (3aR,5S,7aS)-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@H]2C=C1c1ccccc1 |
| InChI | InChI=1S/C23H25NO4S/c1-16-8-10-20(11-9-16)29(26,27)24-14-18-12-21(17-6-4-3-5-7-17)22(23(25)28-2)13-19(18)15-24/h3-12,18-19,22H,13-15H2,1-2H3/t18-,19+,22+/m1/s1 |
| InChIKey | NJVBTLZFJQBEKW-DXIQSLLYSA-N |
| XLogP | 3.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |