C25H31N3O3 — CID 11212347
cis-(2R,3R)-3-hydroxy-2-phenyl-9-[(E)-3-phenylprop-2-enoyl]-1,5,9-triazacyclotridecan-4-one (PubChem CID 11212347) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is cis-(2R,3R)-3-hydroxy-2-phenyl-9-[(E)-3-phenylprop-2-enoyl]-1,5,9-triazacyclotridecan-4-one.
| Compound Name | cis-(2R,3R)-3-hydroxy-2-phenyl-9-[(E)-3-phenylprop-2-enoyl]-1,5,9-triazacyclotridecan-4-one |
|---|---|
| PubChem CID | 11212347 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | cis-(2R,3R)-3-hydroxy-2-phenyl-9-[(E)-3-phenylprop-2-enoyl]-1,5,9-triazacyclotridecan-4-one |
| SMILES | O=C1NCCCN(C(=O)/C=C/c2ccccc2)CCCCN[C@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C25H31N3O3/c29-22(15-14-20-10-3-1-4-11-20)28-18-8-7-16-26-23(21-12-5-2-6-13-21)24(30)25(31)27-17-9-19-28/h1-6,10-15,23-24,26,30H,7-9,16-19H2,(H,27,31)/b15-14+/t23-,24-/m1/s1 |
| InChIKey | FEFXJQOBIJQEHW-NVECHQRWSA-N |
| XLogP | 2.52 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|