C22H21FN4O4 — CID 11212412
propan-2-yl 4-[6-(4-cyano-2-fluorophenoxy)-5-ethynylpyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 11212412) has the molecular formula C22H21FN4O4 and a molecular weight of 424.43 g/mol. Its IUPAC name is propan-2-yl 4-[6-(4-cyano-2-fluorophenoxy)-5-ethynylpyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[6-(4-cyano-2-fluorophenoxy)-5-ethynylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11212412 |
| Molecular Formula | C22H21FN4O4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | propan-2-yl 4-[6-(4-cyano-2-fluorophenoxy)-5-ethynylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | C#Cc1c(Oc2ccc(C#N)cc2F)ncnc1OC1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C22H21FN4O4/c1-4-17-20(30-16-7-9-27(10-8-16)22(28)29-14(2)3)25-13-26-21(17)31-19-6-5-15(12-24)11-18(19)23/h1,5-6,11,13-14,16H,7-10H2,2-3H3 |
| InChIKey | RROARNPQYHNTRB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|