C19H18FN3O5 — CID 87195262
4-[5-ethynyl-6-(2-fluoro-4-methoxyphenoxy)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 87195262) has the molecular formula C19H18FN3O5 and a molecular weight of 387.37 g/mol. Its IUPAC name is 4-[5-ethynyl-6-(2-fluoro-4-methoxyphenoxy)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 4-[5-ethynyl-6-(2-fluoro-4-methoxyphenoxy)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87195262 |
| Molecular Formula | C19H18FN3O5 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-[5-ethynyl-6-(2-fluoro-4-methoxyphenoxy)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | C#Cc1c(Oc2ccc(OC)cc2F)ncnc1OC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C19H18FN3O5/c1-3-14-17(27-12-6-8-23(9-7-12)19(24)25)21-11-22-18(14)28-16-5-4-13(26-2)10-15(16)20/h1,4-5,10-12H,6-9H2,2H3,(H,24,25) |
| InChIKey | IAGAGOZYIUZZGA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|