C21H20Cl3N3O3 — CID 11213533
2,2-dichloro-N-[3-[3-(2-chloro-6-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl]acetamide (PubChem CID 11213533) has the molecular formula C21H20Cl3N3O3 and a molecular weight of 468.77 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[3-(2-chloro-6-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[3-(2-chloro-6-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 11213533 |
| Molecular Formula | C21H20Cl3N3O3 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2,2-dichloro-N-[3-[3-(2-chloro-6-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc(C2CC(c3c(Cl)cccc3N3CCOCC3)=NO2)c1)C(Cl)Cl |
| InChI | InChI=1S/C21H20Cl3N3O3/c22-15-5-2-6-17(27-7-9-29-10-8-27)19(15)16-12-18(30-26-16)13-3-1-4-14(11-13)25-21(28)20(23)24/h1-6,11,18,20H,7-10,12H2,(H,25,28) |
| InChIKey | DSPWSHLZDCIQNO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|