C21H26Cl2N2O3 — CID 11903343
N-[3-[(2S,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dichloroacetamide (PubChem CID 11903343) has the molecular formula C21H26Cl2N2O3 and a molecular weight of 425.36 g/mol. Its IUPAC name is N-[3-[(2S,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dichloroacetamide.
| Compound Name | N-[3-[(2S,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 11903343 |
| Molecular Formula | C21H26Cl2N2O3 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[3-[(2S,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dichloroacetamide |
| SMILES | O=C(Nc1cccc([C@@H]2C[C@H]3CN(C(=O)C4CCCC4)CC[C@@H]3O2)c1)C(Cl)Cl |
| InChI | InChI=1S/C21H26Cl2N2O3/c22-19(23)20(26)24-16-7-3-6-14(10-16)18-11-15-12-25(9-8-17(15)28-18)21(27)13-4-1-2-5-13/h3,6-7,10,13,15,17-19H,1-2,4-5,8-9,11-12H2,(H,24,26)/t15-,17-,18-/m0/s1 |
| InChIKey | PAONIFCFPWLOGU-SZMVWBNQSA-N |
| XLogP | 4.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|