C21H27ClN2O3 — CID 11903434
N-[3-[(2S,3aR,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2-chloroacetamide (PubChem CID 11903434) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is N-[3-[(2S,3aR,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2-chloroacetamide.
| Compound Name | N-[3-[(2S,3aR,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 11903434 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[3-[(2S,3aR,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-2-chloroacetamide |
| SMILES | O=C(CCl)Nc1cccc([C@@H]2C[C@@H]3CN(C(=O)C4CCCC4)CC[C@@H]3O2)c1 |
| InChI | InChI=1S/C21H27ClN2O3/c22-12-20(25)23-17-7-3-6-15(10-17)19-11-16-13-24(9-8-18(16)27-19)21(26)14-4-1-2-5-14/h3,6-7,10,14,16,18-19H,1-2,4-5,8-9,11-13H2,(H,23,25)/t16-,18+,19+/m1/s1 |
| InChIKey | ROCYFDYXLAQPBE-NEWSRXKRSA-N |
| XLogP | 3.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|