C25H34N2O3 — CID 11894641
N-[3-[(2R,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]cyclopentanecarboxamide (PubChem CID 11894641) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[3-[(2R,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[(2R,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 11894641 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[3-[(2R,3aS,7aS)-5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1cccc([C@H]2C[C@H]3CN(C(=O)C4CCCC4)CC[C@@H]3O2)c1)C1CCCC1 |
| InChI | InChI=1S/C25H34N2O3/c28-24(17-6-1-2-7-17)26-21-11-5-10-19(14-21)23-15-20-16-27(13-12-22(20)30-23)25(29)18-8-3-4-9-18/h5,10-11,14,17-18,20,22-23H,1-4,6-9,12-13,15-16H2,(H,26,28)/t20-,22-,23+/m0/s1 |
| InChIKey | UZADJMBJKIUDND-ACIOBRDBSA-N |
| XLogP | 4.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |