C30H32N2O3 — CID 5113847
N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]naphthalene-1-carboxamide (PubChem CID 5113847) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 5113847 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1cccc(C2CC3CN(C(=O)C4CCCC4)CCC3O2)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H32N2O3/c33-29(26-14-6-10-20-7-3-4-13-25(20)26)31-24-12-5-11-22(17-24)28-18-23-19-32(16-15-27(23)35-28)30(34)21-8-1-2-9-21/h3-7,10-14,17,21,23,27-28H,1-2,8-9,15-16,18-19H2,(H,31,33) |
| InChIKey | FAXHVKPIODPSKS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |