C27H30N2O5 — CID 4038804
N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4038804) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4038804 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[3-[5-(cyclopentanecarbonyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-2-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1cccc(C2CC3CN(C(=O)C4CCCC4)CCC3O2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H30N2O5/c30-26(19-8-9-23-25(13-19)33-16-32-23)28-21-7-3-6-18(12-21)24-14-20-15-29(11-10-22(20)34-24)27(31)17-4-1-2-5-17/h3,6-9,12-13,17,20,22,24H,1-2,4-5,10-11,14-16H2,(H,28,30) |
| InChIKey | IQZVSMNVEHPPIQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |