C31H38N4O2 — CID 11214170
(E,4S)-N-[3-(diethylamino)propyl]-5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pent-2-enamide (PubChem CID 11214170) has the molecular formula C31H38N4O2 and a molecular weight of 498.67 g/mol. Its IUPAC name is (E,4S)-N-[3-(diethylamino)propyl]-5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pent-2-enamide.
| Compound Name | (E,4S)-N-[3-(diethylamino)propyl]-5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pent-2-enamide |
|---|---|
| PubChem CID | 11214170 |
| Molecular Formula | C31H38N4O2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (E,4S)-N-[3-(diethylamino)propyl]-5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pent-2-enamide |
| SMILES | CCN(CC)CCCNC(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H38N4O2/c1-3-35(4-2)23-11-22-32-30(36)21-20-29(24-25-12-7-5-8-13-25)34-31(37)33-28-18-16-27(17-19-28)26-14-9-6-10-15-26/h5-10,12-21,29H,3-4,11,22-24H2,1-2H3,(H,32,36)(H2,33,34,37)/b21-20+/t29-/m1/s1 |
| InChIKey | MANUGNXYGMXSRG-ILUFSXPBSA-N |
| XLogP | 5.49 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|