C27H28IN3O3 — CID 70338444
(E,4S)-N-(3-iodopropyl)-4-[(4-phenoxyphenyl)carbamoylamino]-5-phenylpent-2-enamide (PubChem CID 70338444) has the molecular formula C27H28IN3O3 and a molecular weight of 569.44 g/mol. Its IUPAC name is (E,4S)-N-(3-iodopropyl)-4-[(4-phenoxyphenyl)carbamoylamino]-5-phenylpent-2-enamide.
| Compound Name | (E,4S)-N-(3-iodopropyl)-4-[(4-phenoxyphenyl)carbamoylamino]-5-phenylpent-2-enamide |
|---|---|
| PubChem CID | 70338444 |
| Molecular Formula | C27H28IN3O3 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | (E,4S)-N-(3-iodopropyl)-4-[(4-phenoxyphenyl)carbamoylamino]-5-phenylpent-2-enamide |
| SMILES | O=C(/C=C/[C@H](Cc1ccccc1)NC(=O)Nc1ccc(Oc2ccccc2)cc1)NCCCI |
| InChI | InChI=1S/C27H28IN3O3/c28-18-7-19-29-26(32)17-14-23(20-21-8-3-1-4-9-21)31-27(33)30-22-12-15-25(16-13-22)34-24-10-5-2-6-11-24/h1-6,8-17,23H,7,18-20H2,(H,29,32)(H2,30,31,33)/b17-14+/t23-/m1/s1 |
| InChIKey | JQUGVYHVLDFTNL-AKXFXYSNSA-N |
| XLogP | 5.71 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|