C33H43NO6 — CID 11214976
benzyl (2S,5S)-2-[(1R)-5-[(5R,7R)-1,6-dioxaspiro[4.5]decan-7-yl]-1-hydroxypentyl]-5-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 11214976) has the molecular formula C33H43NO6 and a molecular weight of 549.71 g/mol. Its IUPAC name is benzyl (2S,5S)-2-[(1R)-5-[(5R,7R)-1,6-dioxaspiro[4.5]decan-7-yl]-1-hydroxypentyl]-5-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | benzyl (2S,5S)-2-[(1R)-5-[(5R,7R)-1,6-dioxaspiro[4.5]decan-7-yl]-1-hydroxypentyl]-5-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 11214976 |
| Molecular Formula | C33H43NO6 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | benzyl (2S,5S)-2-[(1R)-5-[(5R,7R)-1,6-dioxaspiro[4.5]decan-7-yl]-1-hydroxypentyl]-5-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1[C@H](COCc2ccccc2)C=C[C@H]1[C@H](O)CCCC[C@@H]1CCC[C@]2(CCCO2)O1 |
| InChI | InChI=1S/C33H43NO6/c35-31(17-8-7-15-29-16-9-20-33(40-29)21-10-22-39-33)30-19-18-28(25-37-23-26-11-3-1-4-12-26)34(30)32(36)38-24-27-13-5-2-6-14-27/h1-6,11-14,18-19,28-31,35H,7-10,15-17,20-25H2/t28-,29+,30-,31+,33+/m0/s1 |
| InChIKey | NWHNOAQYVOOXKQ-IUZJZQOCSA-N |
| XLogP | 6.15 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|