C30H53NO6Si2 — CID 11215348
(4R)-4-benzyl-3-[(2R,3S,5R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11215348) has the molecular formula C30H53NO6Si2 and a molecular weight of 579.93 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11215348 |
| Molecular Formula | C30H53NO6Si2 |
| Molecular Weight | 579.93 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@H](O)C[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H53NO6Si2/c1-22(27(33)31-24(21-35-28(31)34)19-23-15-13-12-14-16-23)26(32)20-25(37-39(10,11)30(5,6)7)17-18-36-38(8,9)29(2,3)4/h12-16,22,24-26,32H,17-21H2,1-11H3/t22-,24-,25-,26+/m1/s1 |
| InChIKey | REOPKVMSJHAXLV-RCOXAODPSA-N |
| XLogP | 6.77 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.93 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|