C40H58N8O4S2 — CID 11216505
1-N,3-N-bis[3-(4-aminobutanoylamino)-2-(2-aminoethylsulfanyl)-5-tert-butylphenyl]benzene-1,3-dicarboxamide (PubChem CID 11216505) has the molecular formula C40H58N8O4S2 and a molecular weight of 779.09 g/mol. Its IUPAC name is 1-N,3-N-bis[3-(4-aminobutanoylamino)-2-(2-aminoethylsulfanyl)-5-tert-butylphenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[3-(4-aminobutanoylamino)-2-(2-aminoethylsulfanyl)-5-tert-butylphenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 11216505 |
| Molecular Formula | C40H58N8O4S2 |
| Molecular Weight | 779.09 g/mol |
| Exact Mass | 778.40 |
| IUPAC Name | 1-N,3-N-bis[3-(4-aminobutanoylamino)-2-(2-aminoethylsulfanyl)-5-tert-butylphenyl]benzene-1,3-dicarboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CCCN)c(SCCN)c(NC(=O)c2cccc(C(=O)Nc3cc(C(C)(C)C)cc(NC(=O)CCCN)c3SCCN)c2)c1 |
| InChI | InChI=1S/C40H58N8O4S2/c1-39(2,3)27-21-29(45-33(49)12-8-14-41)35(53-18-16-43)31(23-27)47-37(51)25-10-7-11-26(20-25)38(52)48-32-24-28(40(4,5)6)22-30(36(32)54-19-17-44)46-34(50)13-9-15-42/h7,10-11,20-24H,8-9,12-19,41-44H2,1-6H3,(H,45,49)(H,46,50)(H,47,51)(H,48,52) |
| InChIKey | HWNONSWQPAFYGJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 220.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.09 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |