C34H48N14O4S2 — CID 44632622
4-N,6-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]pyrimidine-4,6-dicarboxamide (PubChem CID 44632622) has the molecular formula C34H48N14O4S2 and a molecular weight of 780.99 g/mol. Its IUPAC name is 4-N,6-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 44632622 |
| Molecular Formula | C34H48N14O4S2 |
| Molecular Weight | 780.99 g/mol |
| Exact Mass | 780.34 |
| IUPAC Name | 4-N,6-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]pyrimidine-4,6-dicarboxamide |
| SMILES | NCCSc1c(NC(=O)CCCCN=C(N)N)cccc1NC(=O)c1cc(C(=O)Nc2cccc(NC(=O)CCCCN=C(N)N)c2SCCN)ncn1 |
| InChI | InChI=1S/C34H48N14O4S2/c35-13-17-53-29-21(45-27(49)11-1-3-15-41-33(37)38)7-5-9-23(29)47-31(51)25-19-26(44-20-43-25)32(52)48-24-10-6-8-22(30(24)54-18-14-36)46-28(50)12-2-4-16-42-34(39)40/h5-10,19-20H,1-4,11-18,35-36H2,(H,45,49)(H,46,50)(H,47,51)(H,48,52)(H4,37,38,41)(H4,39,40,42) |
| InChIKey | IZRQFOGUPCDJIB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 323.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.99 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|