C23H30FN9O4 — CID 122591460
4-N-[3-[5-(diaminomethylideneamino)pentanoylamino]-5-(fluoromethyl)-2-pyrrolidin-3-yloxyphenyl]pyrimidine-4,6-dicarboxamide (PubChem CID 122591460) has the molecular formula C23H30FN9O4 and a molecular weight of 515.55 g/mol. Its IUPAC name is 4-N-[3-[5-(diaminomethylideneamino)pentanoylamino]-5-(fluoromethyl)-2-pyrrolidin-3-yloxyphenyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N-[3-[5-(diaminomethylideneamino)pentanoylamino]-5-(fluoromethyl)-2-pyrrolidin-3-yloxyphenyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 122591460 |
| Molecular Formula | C23H30FN9O4 |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 4-N-[3-[5-(diaminomethylideneamino)pentanoylamino]-5-(fluoromethyl)-2-pyrrolidin-3-yloxyphenyl]pyrimidine-4,6-dicarboxamide |
| SMILES | NC(=O)c1cc(C(=O)Nc2cc(CF)cc(NC(=O)CCCCN=C(N)N)c2OC2CCNC2)ncn1 |
| InChI | InChI=1S/C23H30FN9O4/c24-10-13-7-15(32-19(34)3-1-2-5-29-23(26)27)20(37-14-4-6-28-11-14)16(8-13)33-22(36)18-9-17(21(25)35)30-12-31-18/h7-9,12,14,28H,1-6,10-11H2,(H2,25,35)(H,32,34)(H,33,36)(H4,26,27,29) |
| InChIKey | REHZUTXBTNOXEO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 212.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|