C37H47F6N13O6 — CID 91097045
2-N,4-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide (PubChem CID 91097045) has the molecular formula C37H47F6N13O6 and a molecular weight of 883.86 g/mol. Its IUPAC name is 2-N,4-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 91097045 |
| Molecular Formula | C37H47F6N13O6 |
| Molecular Weight | 883.86 g/mol |
| Exact Mass | 883.37 |
| IUPAC Name | 2-N,4-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyridine-2,4-dicarboxamide |
| SMILES | NCCOc1c(NC(=O)CCCCN=C(N)N)cc(C(F)(F)F)cc1NC(=O)c1ccnc(C(=O)Nc2cc(C(F)(F)F)cc(NC(=O)CCCCN=C(N)N)c2OCCN)c1 |
| InChI | InChI=1S/C37H47F6N13O6/c38-36(39,40)21-16-23(53-28(57)5-1-3-10-51-34(46)47)30(61-13-8-44)25(18-21)55-32(59)20-7-12-50-27(15-20)33(60)56-26-19-22(37(41,42)43)17-24(31(26)62-14-9-45)54-29(58)6-2-4-11-52-35(48)49/h7,12,15-19H,1-6,8-11,13-14,44-45H2,(H,53,57)(H,54,58)(H,55,59)(H,56,60)(H4,46,47,51)(H4,48,49,52) |
| InChIKey | CIVIGDVJDMPLAO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 328.59 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|