C20H28F3N5O3 — CID 143935259
N-[3-acetamido-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-5-(1-aminoethylideneamino)pentanamide (PubChem CID 143935259) has the molecular formula C20H28F3N5O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[3-acetamido-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-5-(1-aminoethylideneamino)pentanamide.
| Compound Name | N-[3-acetamido-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-5-(1-aminoethylideneamino)pentanamide |
|---|---|
| PubChem CID | 143935259 |
| Molecular Formula | C20H28F3N5O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[3-acetamido-2-pyrrolidin-3-yloxy-5-(trifluoromethyl)phenyl]-5-(1-aminoethylideneamino)pentanamide |
| SMILES | CC(=O)Nc1cc(C(F)(F)F)cc(NC(=O)CCCC/N=C(\C)N)c1OC1CCNC1 |
| InChI | InChI=1S/C20H28F3N5O3/c1-12(24)26-7-4-3-5-18(30)28-17-10-14(20(21,22)23)9-16(27-13(2)29)19(17)31-15-6-8-25-11-15/h9-10,15,25H,3-8,11H2,1-2H3,(H2,24,26)(H,27,29)(H,28,30) |
| InChIKey | CETFZOZNYDZEKB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|