C32H34F6N8O6 — CID 90217557
[3-[4-[[3-[5-(diaminomethylideneamino)pentanoylamino]-2-[(3R)-pyrrolidin-3-yl]oxy-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-5-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 90217557) has the molecular formula C32H34F6N8O6 and a molecular weight of 740.66 g/mol. Its IUPAC name is [3-[4-[[3-[5-(diaminomethylideneamino)pentanoylamino]-2-[(3R)-pyrrolidin-3-yl]oxy-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-5-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [3-[4-[[3-[5-(diaminomethylideneamino)pentanoylamino]-2-[(3R)-pyrrolidin-3-yl]oxy-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-5-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 90217557 |
| Molecular Formula | C32H34F6N8O6 |
| Molecular Weight | 740.66 g/mol |
| Exact Mass | 740.25 |
| IUPAC Name | [3-[4-[[3-[5-(diaminomethylideneamino)pentanoylamino]-2-[(3R)-pyrrolidin-3-yl]oxy-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-5-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | NC(N)=NCCCCC(=O)Nc1cc(C(F)(F)F)cc(NC(=O)Nc2ccc(Oc3cc(NC(=O)O)cc(C(F)(F)F)c3)cc2)c1O[C@@H]1CCNC1 |
| InChI | InChI=1S/C32H34F6N8O6/c33-31(34,35)17-11-20(44-30(49)50)15-23(12-17)51-21-6-4-19(5-7-21)43-29(48)46-25-14-18(32(36,37)38)13-24(27(25)52-22-8-10-41-16-22)45-26(47)3-1-2-9-42-28(39)40/h4-7,11-15,22,41,44H,1-3,8-10,16H2,(H,45,47)(H,49,50)(H4,39,40,42)(H2,43,46,48)/t22-/m1/s1 |
| InChIKey | KKTQAFNRMBITII-JOCHJYFZSA-N |
| XLogP | 6.37 |
| TPSA | 214.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.66 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|