C37H53N13O4S2 — CID 123306640
2-N,4-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]-5-ethylpyridine-2,4-dicarboxamide (PubChem CID 123306640) has the molecular formula C37H53N13O4S2 and a molecular weight of 808.05 g/mol. Its IUPAC name is 2-N,4-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]-5-ethylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]-5-ethylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 123306640 |
| Molecular Formula | C37H53N13O4S2 |
| Molecular Weight | 808.05 g/mol |
| Exact Mass | 807.38 |
| IUPAC Name | 2-N,4-N-bis[2-(2-aminoethylsulfanyl)-3-[5-(diaminomethylideneamino)pentanoylamino]phenyl]-5-ethylpyridine-2,4-dicarboxamide |
| SMILES | CCc1cnc(C(=O)Nc2cccc(NC(=O)CCCCN=C(N)N)c2SCCN)cc1C(=O)Nc1cccc(NC(=O)CCCCN=C(N)N)c1SCCN |
| InChI | InChI=1S/C37H53N13O4S2/c1-2-23-22-46-29(35(54)50-28-12-8-10-26(33(28)56-20-16-39)48-31(52)14-4-6-18-45-37(42)43)21-24(23)34(53)49-27-11-7-9-25(32(27)55-19-15-38)47-30(51)13-3-5-17-44-36(40)41/h7-12,21-22H,2-6,13-20,38-39H2,1H3,(H,47,51)(H,48,52)(H,49,53)(H,50,54)(H4,40,41,44)(H4,42,43,45) |
| InChIKey | MWIJMHBQSORUMT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 310.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.05 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|