C10H18O2 — CID 11217496
(4S,5R)-4,5-dimethoxy-4,5-dimethylcyclohexene (PubChem CID 11217496) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (4S,5R)-4,5-dimethoxy-4,5-dimethylcyclohexene.
| Compound Name | (4S,5R)-4,5-dimethoxy-4,5-dimethylcyclohexene |
|---|---|
| PubChem CID | 11217496 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4S,5R)-4,5-dimethoxy-4,5-dimethylcyclohexene |
| SMILES | CO[C@]1(C)CC=CC[C@]1(C)OC |
| InChI | InChI=1S/C10H18O2/c1-9(11-3)7-5-6-8-10(9,2)12-4/h5-6H,7-8H2,1-4H3/t9-,10+ |
| InChIKey | HCZJUVSMCZFUFW-AOOOYVTPSA-N |
| XLogP | 2.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|