C16H26O5 — CID 11220243
diethyl (3aR,7aS)-1,1-dimethyl-3,3a,4,6,7,7a-hexahydro-2-benzofuran-5,5-dicarboxylate (PubChem CID 11220243) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is diethyl (3aR,7aS)-1,1-dimethyl-3,3a,4,6,7,7a-hexahydro-2-benzofuran-5,5-dicarboxylate.
| Compound Name | diethyl (3aR,7aS)-1,1-dimethyl-3,3a,4,6,7,7a-hexahydro-2-benzofuran-5,5-dicarboxylate |
|---|---|
| PubChem CID | 11220243 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | diethyl (3aR,7aS)-1,1-dimethyl-3,3a,4,6,7,7a-hexahydro-2-benzofuran-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@H]2[C@H](COC2(C)C)C1 |
| InChI | InChI=1S/C16H26O5/c1-5-19-13(17)16(14(18)20-6-2)8-7-12-11(9-16)10-21-15(12,3)4/h11-12H,5-10H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | AVLWUVJIMJSDFY-RYUDHWBXSA-N |
| XLogP | 2.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|