C15H18Cl2N2O2 — CID 11221170
(3aR,4S,6R,6aS)-3-(2,6-dichlorophenyl)-4-(ethylamino)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol (PubChem CID 11221170) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is (3aR,4S,6R,6aS)-3-(2,6-dichlorophenyl)-4-(ethylamino)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol.
| Compound Name | (3aR,4S,6R,6aS)-3-(2,6-dichlorophenyl)-4-(ethylamino)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol |
|---|---|
| PubChem CID | 11221170 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (3aR,4S,6R,6aS)-3-(2,6-dichlorophenyl)-4-(ethylamino)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol |
| SMILES | CCN[C@H]1C[C@@](C)(O)[C@H]2ON=C(c3c(Cl)cccc3Cl)[C@@H]12 |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-3-18-10-7-15(2,20)14-12(10)13(19-21-14)11-8(16)5-4-6-9(11)17/h4-6,10,12,14,18,20H,3,7H2,1-2H3/t10-,12+,14-,15+/m0/s1 |
| InChIKey | XEDDAKGSVPRLBX-MMMKDXCPSA-N |
| XLogP | 2.85 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |