C20H27N3O2 — CID 11221525
ethyl 2-(4-methylpiperazin-1-yl)-3-propylquinoline-4-carboxylate (PubChem CID 11221525) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is ethyl 2-(4-methylpiperazin-1-yl)-3-propylquinoline-4-carboxylate.
| Compound Name | ethyl 2-(4-methylpiperazin-1-yl)-3-propylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 11221525 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | ethyl 2-(4-methylpiperazin-1-yl)-3-propylquinoline-4-carboxylate |
| SMILES | CCCc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)OCC |
| InChI | InChI=1S/C20H27N3O2/c1-4-8-16-18(20(24)25-5-2)15-9-6-7-10-17(15)21-19(16)23-13-11-22(3)12-14-23/h6-7,9-10H,4-5,8,11-14H2,1-3H3 |
| InChIKey | SRKSNSDIFZUBNH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |