C20H23ClN2O — CID 11221586
1-(3-chlorophenyl)-2-[1-(6-methyl-1H-indol-3-yl)propan-2-ylamino]ethanol (PubChem CID 11221586) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[1-(6-methyl-1H-indol-3-yl)propan-2-ylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[1-(6-methyl-1H-indol-3-yl)propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 11221586 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[1-(6-methyl-1H-indol-3-yl)propan-2-ylamino]ethanol |
| SMILES | Cc1ccc2c(CC(C)NCC(O)c3cccc(Cl)c3)c[nH]c2c1 |
| InChI | InChI=1S/C20H23ClN2O/c1-13-6-7-18-16(11-23-19(18)8-13)9-14(2)22-12-20(24)15-4-3-5-17(21)10-15/h3-8,10-11,14,20,22-24H,9,12H2,1-2H3 |
| InChIKey | WOWWREMXHNACHB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |