C23H25ClN2O — CID 44591042
3-(4-chlorophenyl)-8-[2-(1H-indol-3-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 44591042) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-8-[2-(1H-indol-3-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(4-chlorophenyl)-8-[2-(1H-indol-3-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 44591042 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-(4-chlorophenyl)-8-[2-(1H-indol-3-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CC2CCC(C1)N2CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H25ClN2O/c24-18-7-5-17(6-8-18)23(27)13-19-9-10-20(14-23)26(19)12-11-16-15-25-22-4-2-1-3-21(16)22/h1-8,15,19-20,25,27H,9-14H2 |
| InChIKey | NXGXYFWRVCUKFN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |