C19H19ClN2O — CID 44591043
3-(4-chlorophenyl)-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol (PubChem CID 44591043) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol.
| Compound Name | 3-(4-chlorophenyl)-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 44591043 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CCN(Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C19H19ClN2O/c20-16-7-5-15(6-8-16)19(23)9-10-22(13-19)12-14-11-21-18-4-2-1-3-17(14)18/h1-8,11,21,23H,9-10,12-13H2 |
| InChIKey | PVPFHWKNLSESPB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |