C18H22N4O3S2 — CID 11223494
ethyl 2,4-diamino-5-[(E)-N-(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-C-methylcarbonimidoyl]thiophene-3-carboxylate (PubChem CID 11223494) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is ethyl 2,4-diamino-5-[(E)-N-(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-C-methylcarbonimidoyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2,4-diamino-5-[(E)-N-(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-C-methylcarbonimidoyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 11223494 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | ethyl 2,4-diamino-5-[(E)-N-(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-C-methylcarbonimidoyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(/C(C)=N/c2sc3c(c2C(N)=O)CCCC3)c1N |
| InChI | InChI=1S/C18H22N4O3S2/c1-3-25-18(24)12-13(19)14(27-16(12)21)8(2)22-17-11(15(20)23)9-6-4-5-7-10(9)26-17/h3-7,19,21H2,1-2H3,(H2,20,23)/b22-8+ |
| InChIKey | OEGQWWHOQMXDDB-GZIVZEMBSA-N |
| XLogP | 3.27 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|